ChemNet > CAS > 19212-42-1 1-(5-Methyl-3-phenylisoxazol-4-yl)ethan-1-on
19212-42-1 1-(5-Methyl-3-phenylisoxazol-4-yl)ethan-1-on
Produkt-Name |
1-(5-Methyl-3-phenylisoxazol-4-yl)ethan-1-on |
Synonyme |
1-(5-Methyl-3-phenyl-1,2-oxazol-4-yl)ethanon |
Englischer Name |
1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one;1-(5-methyl-3-phenyl-1,2-oxazol-4-yl)ethanone |
Molekulare Formel |
C12H11NO2 |
Molecular Weight |
201.2212 |
InChI |
InChI=1/C12H11NO2/c1-8(14)11-9(2)15-13-12(11)10-6-4-3-5-7-10/h3-7H,1-2H3 |
CAS Registry Number |
19212-42-1 |
Molecular Structure |
|
Dichte |
1.127g/cm3 |
Schmelzpunkt |
56℃ |
Siedepunkt |
359°C at 760 mmHg |
Brechungsindex |
1.54 |
Flammpunkt |
170.9°C |
Dampfdruck |
2.46E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|